C16H18F2N2 — CID 62986800
2,6-difluoro-1-N-(3-phenylbutyl)benzene-1,4-diamine (PubChem CID 62986800) has the molecular formula C16H18F2N2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 2,6-difluoro-1-N-(3-phenylbutyl)benzene-1,4-diamine.
| Compound Name | 2,6-difluoro-1-N-(3-phenylbutyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 62986800 |
| Molecular Formula | C16H18F2N2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2,6-difluoro-1-N-(3-phenylbutyl)benzene-1,4-diamine |
| SMILES | CC(CCNc1c(F)cc(N)cc1F)c1ccccc1 |
| InChI | InChI=1S/C16H18F2N2/c1-11(12-5-3-2-4-6-12)7-8-20-16-14(17)9-13(19)10-15(16)18/h2-6,9-11,20H,7-8,19H2,1H3 |
| InChIKey | PEBWPEJLNOBDQI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|