C12H17ClN2O — CID 62986873
5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline (PubChem CID 62986873) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline.
| Compound Name | 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 62986873 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline |
| SMILES | Nc1cc(Cl)ccc1CN1CCCOCC1 |
| InChI | InChI=1S/C12H17ClN2O/c13-11-3-2-10(12(14)8-11)9-15-4-1-6-16-7-5-15/h2-3,8H,1,4-7,9,14H2 |
| InChIKey | RCKWDNFKVBTPFG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|