About 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline
5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline (PubChem CID 62986873) has the molecular formula C12H17ClN2O
and a molecular weight of 240.73 g/mol. Its IUPAC name is 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline.
Molecular Properties
| Compound Name | 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline |
| PubChem CID | 62986873 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline |
| SMILES | Nc1cc(Cl)ccc1CN1CCCOCC1 |
| InChI | InChI=1S/C12H17ClN2O/c13-11-3-2-10(12(14)8-11)9-15-4-1-6-16-7-5-15/h2-3,8H,1,4-7,9,14H2 |
| InChIKey | RCKWDNFKVBTPFG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline?
The IUPAC name of 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline (CID 62986873) is 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline.
What is the SMILES notation for 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline?
The canonical SMILES for 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline is Nc1cc(Cl)ccc1CN1CCCOCC1.
What is the InChIKey of 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline?
The InChIKey is RCKWDNFKVBTPFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN2O/c13-11-3-2-10(12(14)8-11)9-15-4-1-6-16-7-5-15/h2-3,8H,1,4-7,9,14H2.
What are the key properties of 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline?
5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline has a molecular weight of 240.73 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(1,4-oxazepan-4-ylmethyl)aniline is sourced from PubChem (CID 62986873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).