About 4-piperidin-3-yl-1,4-oxazepane
4-piperidin-3-yl-1,4-oxazepane (PubChem CID 62986951) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-piperidin-3-yl-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-piperidin-3-yl-1,4-oxazepane |
| PubChem CID | 62986951 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 4-piperidin-3-yl-1,4-oxazepane |
| SMILES | C1CNCC(N2CCCOCC2)C1 |
| InChI | InChI=1S/C10H20N2O/c1-3-10(9-11-4-1)12-5-2-7-13-8-6-12/h10-11H,1-9H2 |
| InChIKey | MDYZXVNGUCSLOQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-piperidin-3-yl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-3-yl-1,4-oxazepane?
The IUPAC name of 4-piperidin-3-yl-1,4-oxazepane (CID 62986951) is 4-piperidin-3-yl-1,4-oxazepane.
What is the SMILES notation for 4-piperidin-3-yl-1,4-oxazepane?
The canonical SMILES for 4-piperidin-3-yl-1,4-oxazepane is C1CNCC(N2CCCOCC2)C1.
What is the InChIKey of 4-piperidin-3-yl-1,4-oxazepane?
The InChIKey is MDYZXVNGUCSLOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-3-10(9-11-4-1)12-5-2-7-13-8-6-12/h10-11H,1-9H2.
What are the key properties of 4-piperidin-3-yl-1,4-oxazepane?
4-piperidin-3-yl-1,4-oxazepane has a molecular weight of 184.28 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-3-yl-1,4-oxazepane is sourced from PubChem (CID 62986951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).