C8H14ClNO2 — CID 62986954
2-chloro-1-(1,4-oxazepan-4-yl)propan-1-one (PubChem CID 62986954) has the molecular formula C8H14ClNO2 and a molecular weight of 191.66 g/mol. Its IUPAC name is 2-chloro-1-(1,4-oxazepan-4-yl)propan-1-one.
| Compound Name | 2-chloro-1-(1,4-oxazepan-4-yl)propan-1-one |
|---|---|
| PubChem CID | 62986954 |
| Molecular Formula | C8H14ClNO2 |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-chloro-1-(1,4-oxazepan-4-yl)propan-1-one |
| SMILES | CC(Cl)C(=O)N1CCCOCC1 |
| InChI | InChI=1S/C8H14ClNO2/c1-7(9)8(11)10-3-2-5-12-6-4-10/h7H,2-6H2,1H3 |
| InChIKey | POVSVSNKOUZLGI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|