C8H14F3NO2S — CID 62987551
N-[2-(1,1-dioxothiolan-3-yl)ethyl]-2,2,2-trifluoroethanamine (PubChem CID 62987551) has the molecular formula C8H14F3NO2S and a molecular weight of 245.27 g/mol. Its IUPAC name is N-[2-(1,1-dioxothiolan-3-yl)ethyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-[2-(1,1-dioxothiolan-3-yl)ethyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 62987551 |
| Molecular Formula | C8H14F3NO2S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-[2-(1,1-dioxothiolan-3-yl)ethyl]-2,2,2-trifluoroethanamine |
| SMILES | O=S1(=O)CCC(CCNCC(F)(F)F)C1 |
| InChI | InChI=1S/C8H14F3NO2S/c9-8(10,11)6-12-3-1-7-2-4-15(13,14)5-7/h7,12H,1-6H2 |
| InChIKey | JZWKFRIIHFRGGF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|