C11H15BrN2O — CID 62988135
5-bromo-2-(1,4-oxazepan-4-yl)aniline (PubChem CID 62988135) has the molecular formula C11H15BrN2O and a molecular weight of 271.16 g/mol. Its IUPAC name is 5-bromo-2-(1,4-oxazepan-4-yl)aniline.
| Compound Name | 5-bromo-2-(1,4-oxazepan-4-yl)aniline |
|---|---|
| PubChem CID | 62988135 |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 5-bromo-2-(1,4-oxazepan-4-yl)aniline |
| SMILES | Nc1cc(Br)ccc1N1CCCOCC1 |
| InChI | InChI=1S/C11H15BrN2O/c12-9-2-3-11(10(13)8-9)14-4-1-6-15-7-5-14/h2-3,8H,1,4-7,13H2 |
| InChIKey | ZXVQLUFAOBOYCF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|