About 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile
3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile (PubChem CID 62988698) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile.
Molecular Properties
| Compound Name | 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile |
| PubChem CID | 62988698 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile |
| SMILES | CC1CN(C(C)CC#N)CCCO1 |
| InChI | InChI=1S/C10H18N2O/c1-9(4-5-11)12-6-3-7-13-10(2)8-12/h9-10H,3-4,6-8H2,1-2H3 |
| InChIKey | FAEGYSODKYZPNI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile?
The IUPAC name of 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile (CID 62988698) is 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile.
What is the SMILES notation for 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile?
The canonical SMILES for 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile is CC1CN(C(C)CC#N)CCCO1.
What is the InChIKey of 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile?
The InChIKey is FAEGYSODKYZPNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-9(4-5-11)12-6-3-7-13-10(2)8-12/h9-10H,3-4,6-8H2,1-2H3.
What are the key properties of 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile?
3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile has a molecular weight of 182.27 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,4-oxazepan-4-yl)butanenitrile is sourced from PubChem (CID 62988698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).