About 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine
4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 62989048) has the molecular formula C10H17N3OS
and a molecular weight of 227.33 g/mol. Its IUPAC name is 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine |
| PubChem CID | 62989048 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | CC1CN(Cc2csc(N)n2)CCCO1 |
| InChI | InChI=1S/C10H17N3OS/c1-8-5-13(3-2-4-14-8)6-9-7-15-10(11)12-9/h7-8H,2-6H2,1H3,(H2,11,12) |
| InChIKey | OFGQGGSUELUNOQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine?
The IUPAC name of 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine (CID 62989048) is 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine?
The canonical SMILES for 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine is CC1CN(Cc2csc(N)n2)CCCO1.
What is the InChIKey of 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine?
The InChIKey is OFGQGGSUELUNOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3OS/c1-8-5-13(3-2-4-14-8)6-9-7-15-10(11)12-9/h7-8H,2-6H2,1H3,(H2,11,12).
What are the key properties of 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine?
4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine has a molecular weight of 227.33 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methyl-1,4-oxazepan-4-yl)methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 62989048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).