C20H40O3Si2 — CID 629894
[tert-butyl(dimethyl)silyl] 7-[tert-butyl(dimethyl)silyl]oxyoct-4-ynoate (PubChem CID 629894) has the molecular formula C20H40O3Si2 and a molecular weight of 384.71 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 7-[tert-butyl(dimethyl)silyl]oxyoct-4-ynoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 7-[tert-butyl(dimethyl)silyl]oxyoct-4-ynoate |
|---|---|
| PubChem CID | 629894 |
| Molecular Formula | C20H40O3Si2 |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 7-[tert-butyl(dimethyl)silyl]oxyoct-4-ynoate |
| SMILES | CC(CC#CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O3Si2/c1-17(22-24(8,9)19(2,3)4)15-13-12-14-16-18(21)23-25(10,11)20(5,6)7/h17H,14-16H2,1-11H3 |
| InChIKey | HSNURNBEZOGJLK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|