C11H19N3O — CID 62989600
N-(1,2-oxazol-4-ylmethyl)-3-pyrrolidin-1-ylpropan-1-amine (PubChem CID 62989600) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(1,2-oxazol-4-ylmethyl)-3-pyrrolidin-1-ylpropan-1-amine.
| Compound Name | N-(1,2-oxazol-4-ylmethyl)-3-pyrrolidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 62989600 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-(1,2-oxazol-4-ylmethyl)-3-pyrrolidin-1-ylpropan-1-amine |
| SMILES | c1nocc1CNCCCN1CCCC1 |
| InChI | InChI=1S/C11H19N3O/c1-2-6-14(5-1)7-3-4-12-8-11-9-13-15-10-11/h9-10,12H,1-8H2 |
| InChIKey | UFQHNCPATUVNLE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|