C14H16FN3S — CID 62989973
3-cyclopropyl-4-[1-(4-fluorophenyl)propan-2-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 62989973) has the molecular formula C14H16FN3S and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-cyclopropyl-4-[1-(4-fluorophenyl)propan-2-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-cyclopropyl-4-[1-(4-fluorophenyl)propan-2-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 62989973 |
| Molecular Formula | C14H16FN3S |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-cyclopropyl-4-[1-(4-fluorophenyl)propan-2-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | CC(Cc1ccc(F)cc1)n1c(C2CC2)n[nH]c1=S |
| InChI | InChI=1S/C14H16FN3S/c1-9(8-10-2-6-12(15)7-3-10)18-13(11-4-5-11)16-17-14(18)19/h2-3,6-7,9,11H,4-5,8H2,1H3,(H,17,19) |
| InChIKey | GEKSDFFJVORPCM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|