C14H14F3N3O — CID 62990420
1-N-[(6-methoxy-3-pyridinyl)methyl]-4-(trifluoromethyl)benzene-1,2-diamine (PubChem CID 62990420) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is 1-N-[(6-methoxy-3-pyridinyl)methyl]-4-(trifluoromethyl)benzene-1,2-diamine.
| Compound Name | 1-N-[(6-methoxy-3-pyridinyl)methyl]-4-(trifluoromethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 62990420 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-N-[(6-methoxy-3-pyridinyl)methyl]-4-(trifluoromethyl)benzene-1,2-diamine |
| SMILES | COc1ccc(CNc2ccc(C(F)(F)F)cc2N)cn1 |
| InChI | InChI=1S/C14H14F3N3O/c1-21-13-5-2-9(8-20-13)7-19-12-4-3-10(6-11(12)18)14(15,16)17/h2-6,8,19H,7,18H2,1H3 |
| InChIKey | DDRIIAXVGAKABT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|