About Citronellal oxime
Citronellal oxime (PubChem CID 6299203) has the molecular formula C10H19NO
and a molecular weight of 169.26 g/mol. Its IUPAC name is (NZ)-N-(3,7-dimethyloct-6-enylidene)hydroxylamine.
Molecular Properties
| Compound Name | Citronellal oxime |
| PubChem CID | 6299203 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.26 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (NZ)-N-(3,7-dimethyloct-6-enylidene)hydroxylamine |
| SMILES | CC(CCC=C(C)C)C/C=N\O |
| InChI | InChI=1S/C10H19NO/c1-9(2)5-4-6-10(3)7-8-11-12/h5,8,10,12H,4,6-7H2,1-3H3/b11-8- |
| InChIKey | JUCCIEVMICHZPK-FLIBITNWSA-N |
| XLogP | 3.20 |
| TPSA | 32.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | 157 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Citronellal oxime with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Citronellal oxime?
The IUPAC name of Citronellal oxime (CID 6299203) is (NZ)-N-(3,7-dimethyloct-6-enylidene)hydroxylamine.
What is the SMILES notation for Citronellal oxime?
The canonical SMILES for Citronellal oxime is CC(CCC=C(C)C)C/C=N\O.
What is the InChIKey of Citronellal oxime?
The InChIKey is JUCCIEVMICHZPK-FLIBITNWSA-N. The full InChI is InChI=1S/C10H19NO/c1-9(2)5-4-6-10(3)7-8-11-12/h5,8,10,12H,4,6-7H2,1-3H3/b11-8-.
What are the key properties of Citronellal oxime?
Citronellal oxime has a molecular weight of 169.26 g/mol, XLogP of 3.20, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Citronellal oxime is sourced from PubChem (CID 6299203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).