C17H33N3O — CID 62992458
3-(2-aminoethyl)-N-(2-methyl-3-pyrrolidin-1-ylpropyl)cyclohexane-1-carboxamide (PubChem CID 62992458) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is 3-(2-aminoethyl)-N-(2-methyl-3-pyrrolidin-1-ylpropyl)cyclohexane-1-carboxamide.
| Compound Name | 3-(2-aminoethyl)-N-(2-methyl-3-pyrrolidin-1-ylpropyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 62992458 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | 3-(2-aminoethyl)-N-(2-methyl-3-pyrrolidin-1-ylpropyl)cyclohexane-1-carboxamide |
| SMILES | CC(CNC(=O)C1CCCC(CCN)C1)CN1CCCC1 |
| InChI | InChI=1S/C17H33N3O/c1-14(13-20-9-2-3-10-20)12-19-17(21)16-6-4-5-15(11-16)7-8-18/h14-16H,2-13,18H2,1H3,(H,19,21) |
| InChIKey | LVRPARWAPWMAFR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |