C13H24N4O2S — CID 62992780
2-(cyclopropylamino)-2-methyl-4-(4-methylsulfonylpiperazin-1-yl)butanenitrile (PubChem CID 62992780) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-methyl-4-(4-methylsulfonylpiperazin-1-yl)butanenitrile.
| Compound Name | 2-(cyclopropylamino)-2-methyl-4-(4-methylsulfonylpiperazin-1-yl)butanenitrile |
|---|---|
| PubChem CID | 62992780 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-(cyclopropylamino)-2-methyl-4-(4-methylsulfonylpiperazin-1-yl)butanenitrile |
| SMILES | CC(C#N)(CCN1CCN(S(C)(=O)=O)CC1)NC1CC1 |
| InChI | InChI=1S/C13H24N4O2S/c1-13(11-14,15-12-3-4-12)5-6-16-7-9-17(10-8-16)20(2,18)19/h12,15H,3-10H2,1-2H3 |
| InChIKey | BJFXSSSHDFJZOE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |