diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate

C19H21NO4 — CID 629929

IUPACdiethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate
SMILESCCOC(=O)c1c(C)nc(C)c(C(=O)OCC)c1-c1ccccc1
InChIInChI=1S/C19H21NO4/c1-5-23-18(21)15-12(3)20-13(4)16(19(22)24-6-2)17(15)14-10-8-7-9-11-14/h7-11H,5-6H2,1-4H3
InChIKeyVQDKSJMDSZZJER-UHFFFAOYSA-N
MW327.38 g/mol
LogP3.72
Rot. Bonds5

About diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate

diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate (PubChem CID 629929) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate.

Molecular Properties

Compound Namediethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate
PubChem CID629929
Molecular FormulaC19H21NO4
Molecular Weight327.38 g/mol
Exact Mass327.15
IUPAC Namediethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate
SMILESCCOC(=O)c1c(C)nc(C)c(C(=O)OCC)c1-c1ccccc1
InChIInChI=1S/C19H21NO4/c1-5-23-18(21)15-12(3)20-13(4)16(19(22)24-6-2)17(15)14-10-8-7-9-11-14/h7-11H,5-6H2,1-4H3
InChIKeyVQDKSJMDSZZJER-UHFFFAOYSA-N
XLogP3.72
TPSA65.49 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.38
LogP ≤ 53.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate?
The IUPAC name of diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate (CID 629929) is diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate.
What is the SMILES notation for diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate?
The canonical SMILES for diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate is CCOC(=O)c1c(C)nc(C)c(C(=O)OCC)c1-c1ccccc1.
What is the InChIKey of diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate?
The InChIKey is VQDKSJMDSZZJER-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO4/c1-5-23-18(21)15-12(3)20-13(4)16(19(22)24-6-2)17(15)14-10-8-7-9-11-14/h7-11H,5-6H2,1-4H3.
What are the key properties of diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate?
diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate has a molecular weight of 327.38 g/mol, XLogP of 3.72, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylate is sourced from PubChem (CID 629929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).