C12H24N4O3S2 — CID 62994125
N-(3-amino-3-sulfanylidenepropyl)-N-methyl-3-(4-methylsulfonylpiperazin-1-yl)propanamide (PubChem CID 62994125) has the molecular formula C12H24N4O3S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-methyl-3-(4-methylsulfonylpiperazin-1-yl)propanamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-methyl-3-(4-methylsulfonylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 62994125 |
| Molecular Formula | C12H24N4O3S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-methyl-3-(4-methylsulfonylpiperazin-1-yl)propanamide |
| SMILES | CN(CCC(N)=S)C(=O)CCN1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C12H24N4O3S2/c1-14(5-3-11(13)20)12(17)4-6-15-7-9-16(10-8-15)21(2,18)19/h3-10H2,1-2H3,(H2,13,20) |
| InChIKey | GCPZKVSUYBGINO-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|