About [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate
[4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate (PubChem CID 6299482) has the molecular formula C28H25BrN2O4S2
and a molecular weight of 597.56 g/mol. Its IUPAC name is [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate.
Molecular Properties
| Compound Name | [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate |
| PubChem CID | 6299482 |
| Molecular Formula | C28H25BrN2O4S2 |
| Molecular Weight | 597.56 g/mol |
| Exact Mass | 596.04 |
| IUPAC Name | [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(-c2cs/c(=N/S(=O)(=O)c3ccc(Br)cc3)n2C2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H25BrN2O4S2/c29-22-13-17-25(18-14-22)37(33,34)30-28-31(23-9-5-2-6-10-23)26(19-36-28)20-11-15-24(16-12-20)35-27(32)21-7-3-1-4-8-21/h1,3-4,7-8,11-19,23H,2,5-6,9-10H2/b30-28+ |
| InChIKey | BYCSFQVHSKZQHC-SJCQXOIGSA-N |
| XLogP | 6.99 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 597.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate?
The IUPAC name of [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate (CID 6299482) is [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate.
What is the SMILES notation for [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate?
The canonical SMILES for [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate is O=C(Oc1ccc(-c2cs/c(=N/S(=O)(=O)c3ccc(Br)cc3)n2C2CCCCC2)cc1)c1ccccc1.
What is the InChIKey of [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate?
The InChIKey is BYCSFQVHSKZQHC-SJCQXOIGSA-N. The full InChI is InChI=1S/C28H25BrN2O4S2/c29-22-13-17-25(18-14-22)37(33,34)30-28-31(23-9-5-2-6-10-23)26(19-36-28)20-11-15-24(16-12-20)35-27(32)21-7-3-1-4-8-21/h1,3-4,7-8,11-19,23H,2,5-6,9-10H2/b30-28+.
What are the key properties of [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate?
[4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate has a molecular weight of 597.56 g/mol, XLogP of 6.99, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2E)-2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate is sourced from PubChem (CID 6299482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).