C13H21NOS2 — CID 62995172
1-(oxan-4-ylsulfanyl)-1-thiophen-2-ylbutan-2-amine (PubChem CID 62995172) has the molecular formula C13H21NOS2 and a molecular weight of 271.45 g/mol. Its IUPAC name is 1-(oxan-4-ylsulfanyl)-1-thiophen-2-ylbutan-2-amine.
| Compound Name | 1-(oxan-4-ylsulfanyl)-1-thiophen-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 62995172 |
| Molecular Formula | C13H21NOS2 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-(oxan-4-ylsulfanyl)-1-thiophen-2-ylbutan-2-amine |
| SMILES | CCC(N)C(SC1CCOCC1)c1cccs1 |
| InChI | InChI=1S/C13H21NOS2/c1-2-11(14)13(12-4-3-9-16-12)17-10-5-7-15-8-6-10/h3-4,9-11,13H,2,5-8,14H2,1H3 |
| InChIKey | NTEQEEHYCRCQSC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |