C12H24N2O4 — CID 62996165
2-[[3-methoxypropyl(methyl)carbamoyl]amino]-3,3-dimethylbutanoic acid (PubChem CID 62996165) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-[[3-methoxypropyl(methyl)carbamoyl]amino]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[[3-methoxypropyl(methyl)carbamoyl]amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 62996165 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-[[3-methoxypropyl(methyl)carbamoyl]amino]-3,3-dimethylbutanoic acid |
| SMILES | COCCCN(C)C(=O)NC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O4/c1-12(2,3)9(10(15)16)13-11(17)14(4)7-6-8-18-5/h9H,6-8H2,1-5H3,(H,13,17)(H,15,16) |
| InChIKey | XVNHWQSNOWJPBH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|