C13H17FN2O3 — CID 62997070
2-[1-(4-fluorophenyl)propan-2-ylcarbamoylamino]propanoic acid (PubChem CID 62997070) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)propan-2-ylcarbamoylamino]propanoic acid.
| Compound Name | 2-[1-(4-fluorophenyl)propan-2-ylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 62997070 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[1-(4-fluorophenyl)propan-2-ylcarbamoylamino]propanoic acid |
| SMILES | CC(Cc1ccc(F)cc1)NC(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C13H17FN2O3/c1-8(7-10-3-5-11(14)6-4-10)15-13(19)16-9(2)12(17)18/h3-6,8-9H,7H2,1-2H3,(H,17,18)(H2,15,16,19) |
| InChIKey | BNEPVITUQFNNKX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |