C8H12N4S — CID 62997191
1-amino-3-[(6-methyl-3-pyridinyl)methyl]thiourea (PubChem CID 62997191) has the molecular formula C8H12N4S and a molecular weight of 196.28 g/mol. Its IUPAC name is 1-amino-3-[(6-methyl-3-pyridinyl)methyl]thiourea.
| Compound Name | 1-amino-3-[(6-methyl-3-pyridinyl)methyl]thiourea |
|---|---|
| PubChem CID | 62997191 |
| Molecular Formula | C8H12N4S |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-amino-3-[(6-methyl-3-pyridinyl)methyl]thiourea |
| SMILES | Cc1ccc(CNC(=S)NN)cn1 |
| InChI | InChI=1S/C8H12N4S/c1-6-2-3-7(4-10-6)5-11-8(13)12-9/h2-4H,5,9H2,1H3,(H2,11,12,13) |
| InChIKey | HEWLTGVRTGMEGD-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|