C13H14FN3 — CID 62997267
3-fluoro-1-N-[(6-methyl-3-pyridinyl)methyl]benzene-1,2-diamine (PubChem CID 62997267) has the molecular formula C13H14FN3 and a molecular weight of 231.27 g/mol. Its IUPAC name is 3-fluoro-1-N-[(6-methyl-3-pyridinyl)methyl]benzene-1,2-diamine.
| Compound Name | 3-fluoro-1-N-[(6-methyl-3-pyridinyl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 62997267 |
| Molecular Formula | C13H14FN3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 3-fluoro-1-N-[(6-methyl-3-pyridinyl)methyl]benzene-1,2-diamine |
| SMILES | Cc1ccc(CNc2cccc(F)c2N)cn1 |
| InChI | InChI=1S/C13H14FN3/c1-9-5-6-10(7-16-9)8-17-12-4-2-3-11(14)13(12)15/h2-7,17H,8,15H2,1H3 |
| InChIKey | NRFIKGVWYGVRSB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|