About N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide
N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide (PubChem CID 62998938) has the molecular formula C12H11ClN4O3S
and a molecular weight of 326.77 g/mol. Its IUPAC name is N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide |
| PubChem CID | 62998938 |
| Molecular Formula | C12H11ClN4O3S |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)Nc2cc3c(cc2Cl)NC(=O)C3)[nH]1 |
| InChI | InChI=1S/C12H11ClN4O3S/c1-6-14-5-12(15-6)21(19,20)17-10-2-7-3-11(18)16-9(7)4-8(10)13/h2,4-5,17H,3H2,1H3,(H,14,15)(H,16,18) |
| InChIKey | FWTIJPVYHGHODU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide?
The IUPAC name of N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide (CID 62998938) is N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide.
What is the SMILES notation for N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide?
The canonical SMILES for N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide is Cc1ncc(S(=O)(=O)Nc2cc3c(cc2Cl)NC(=O)C3)[nH]1.
What is the InChIKey of N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide?
The InChIKey is FWTIJPVYHGHODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN4O3S/c1-6-14-5-12(15-6)21(19,20)17-10-2-7-3-11(18)16-9(7)4-8(10)13/h2,4-5,17H,3H2,1H3,(H,14,15)(H,16,18).
What are the key properties of N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide?
N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide has a molecular weight of 326.77 g/mol, XLogP of 1.67, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)-2-methyl-1H-imidazole-5-sulfonamide is sourced from PubChem (CID 62998938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).