About 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one
1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one (PubChem CID 62999023) has the molecular formula C9H14N4OS
and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one |
| PubChem CID | 62999023 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one |
| SMILES | NCc1cnc(N2CCNC(=O)CC2)s1 |
| InChI | InChI=1S/C9H14N4OS/c10-5-7-6-12-9(15-7)13-3-1-8(14)11-2-4-13/h6H,1-5,10H2,(H,11,14) |
| InChIKey | OTYHBOPHNLLROY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one?
The IUPAC name of 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one (CID 62999023) is 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one.
What is the SMILES notation for 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one?
The canonical SMILES for 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one is NCc1cnc(N2CCNC(=O)CC2)s1.
What is the InChIKey of 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one?
The InChIKey is OTYHBOPHNLLROY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4OS/c10-5-7-6-12-9(15-7)13-3-1-8(14)11-2-4-13/h6H,1-5,10H2,(H,11,14).
What are the key properties of 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one?
1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one has a molecular weight of 226.30 g/mol, XLogP of -0.07, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(aminomethyl)-1,3-thiazol-2-yl]-1,4-diazepan-5-one is sourced from PubChem (CID 62999023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).