C14H14N4S — CID 62999432
1-benzyl-N-(1,3-thiazol-2-ylmethyl)pyrazol-4-amine (PubChem CID 62999432) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 1-benzyl-N-(1,3-thiazol-2-ylmethyl)pyrazol-4-amine.
| Compound Name | 1-benzyl-N-(1,3-thiazol-2-ylmethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 62999432 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-benzyl-N-(1,3-thiazol-2-ylmethyl)pyrazol-4-amine |
| SMILES | c1ccc(Cn2cc(NCc3nccs3)cn2)cc1 |
| InChI | InChI=1S/C14H14N4S/c1-2-4-12(5-3-1)10-18-11-13(8-17-18)16-9-14-15-6-7-19-14/h1-8,11,16H,9-10H2 |
| InChIKey | FDTVNDXHLYFNPB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |