About 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide
2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide (PubChem CID 62999978) has the molecular formula C8H10N4O2S2
and a molecular weight of 258.33 g/mol. Its IUPAC name is 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide |
| PubChem CID | 62999978 |
| Molecular Formula | C8H10N4O2S2 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide |
| SMILES | Cc1csc(NS(=O)(=O)c2cnc(C)[nH]2)n1 |
| InChI | InChI=1S/C8H10N4O2S2/c1-5-4-15-8(10-5)12-16(13,14)7-3-9-6(2)11-7/h3-4H,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | KYTNLARPNMNEPL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide?
The IUPAC name of 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide (CID 62999978) is 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide.
What is the SMILES notation for 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide?
The canonical SMILES for 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide is Cc1csc(NS(=O)(=O)c2cnc(C)[nH]2)n1.
What is the InChIKey of 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide?
The InChIKey is KYTNLARPNMNEPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2S2/c1-5-4-15-8(10-5)12-16(13,14)7-3-9-6(2)11-7/h3-4H,1-2H3,(H,9,11)(H,10,12).
What are the key properties of 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide?
2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide has a molecular weight of 258.33 g/mol, XLogP of 1.28, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(4-methyl-1,3-thiazol-2-yl)-1H-imidazole-5-sulfonamide is sourced from PubChem (CID 62999978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).