C9H14F3N3O — CID 63000956
N-[(2-methyl-1H-imidazol-5-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 63000956) has the molecular formula C9H14F3N3O and a molecular weight of 237.22 g/mol. Its IUPAC name is N-[(2-methyl-1H-imidazol-5-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[(2-methyl-1H-imidazol-5-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 63000956 |
| Molecular Formula | C9H14F3N3O |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N-[(2-methyl-1H-imidazol-5-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | Cc1ncc(CNCCOCC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C9H14F3N3O/c1-7-14-5-8(15-7)4-13-2-3-16-6-9(10,11)12/h5,13H,2-4,6H2,1H3,(H,14,15) |
| InChIKey | RILIJLUPSKZASC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|