C11H19N5O2 — CID 63003001
1-[3-(4-aminopyrazol-1-yl)-2-hydroxypropyl]-1,4-diazepan-5-one (PubChem CID 63003001) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 1-[3-(4-aminopyrazol-1-yl)-2-hydroxypropyl]-1,4-diazepan-5-one.
| Compound Name | 1-[3-(4-aminopyrazol-1-yl)-2-hydroxypropyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 63003001 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-[3-(4-aminopyrazol-1-yl)-2-hydroxypropyl]-1,4-diazepan-5-one |
| SMILES | Nc1cnn(CC(O)CN2CCNC(=O)CC2)c1 |
| InChI | InChI=1S/C11H19N5O2/c12-9-5-14-16(6-9)8-10(17)7-15-3-1-11(18)13-2-4-15/h5-6,10,17H,1-4,7-8,12H2,(H,13,18) |
| InChIKey | ZZCHVPBYUOGCTH-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |