About 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one
1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one (PubChem CID 63003452) has the molecular formula C15H19N3O
and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one |
| PubChem CID | 63003452 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one |
| SMILES | NCC#Cc1ccccc1CN1CCNC(=O)CC1 |
| InChI | InChI=1S/C15H19N3O/c16-8-3-6-13-4-1-2-5-14(13)12-18-10-7-15(19)17-9-11-18/h1-2,4-5H,7-12,16H2,(H,17,19) |
| InChIKey | QUCSTJKMRZUKIW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one?
The IUPAC name of 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one (CID 63003452) is 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one.
What is the SMILES notation for 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one?
The canonical SMILES for 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one is NCC#Cc1ccccc1CN1CCNC(=O)CC1.
What is the InChIKey of 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one?
The InChIKey is QUCSTJKMRZUKIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O/c16-8-3-6-13-4-1-2-5-14(13)12-18-10-7-15(19)17-9-11-18/h1-2,4-5H,7-12,16H2,(H,17,19).
What are the key properties of 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one?
1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one has a molecular weight of 257.34 g/mol, XLogP of 0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(3-aminoprop-1-ynyl)phenyl]methyl]-1,4-diazepan-5-one is sourced from PubChem (CID 63003452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).