C16H22N2O2 — CID 63003643
1-[1-(4-ethylphenyl)-1-oxopropan-2-yl]-1,4-diazepan-5-one (PubChem CID 63003643) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-[1-(4-ethylphenyl)-1-oxopropan-2-yl]-1,4-diazepan-5-one.
| Compound Name | 1-[1-(4-ethylphenyl)-1-oxopropan-2-yl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 63003643 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[1-(4-ethylphenyl)-1-oxopropan-2-yl]-1,4-diazepan-5-one |
| SMILES | CCc1ccc(C(=O)C(C)N2CCNC(=O)CC2)cc1 |
| InChI | InChI=1S/C16H22N2O2/c1-3-13-4-6-14(7-5-13)16(20)12(2)18-10-8-15(19)17-9-11-18/h4-7,12H,3,8-11H2,1-2H3,(H,17,19) |
| InChIKey | HOEAGHFTDJYNJK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |