C11H19N3 — CID 63004274
5-N-(4-methylpentyl)pyridine-2,5-diamine (PubChem CID 63004274) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 5-N-(4-methylpentyl)pyridine-2,5-diamine.
| Compound Name | 5-N-(4-methylpentyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 63004274 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 5-N-(4-methylpentyl)pyridine-2,5-diamine |
| SMILES | CC(C)CCCNc1ccc(N)nc1 |
| InChI | InChI=1S/C11H19N3/c1-9(2)4-3-7-13-10-5-6-11(12)14-8-10/h5-6,8-9,13H,3-4,7H2,1-2H3,(H2,12,14) |
| InChIKey | ZKQLNBGTQNEDAP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|