C13H15N3O3 — CID 63004308
3-hydroxy-6-(5-oxo-1,4-diazepan-1-yl)-1,3-dihydroindol-2-one (PubChem CID 63004308) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-hydroxy-6-(5-oxo-1,4-diazepan-1-yl)-1,3-dihydroindol-2-one.
| Compound Name | 3-hydroxy-6-(5-oxo-1,4-diazepan-1-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63004308 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 3-hydroxy-6-(5-oxo-1,4-diazepan-1-yl)-1,3-dihydroindol-2-one |
| SMILES | O=C1CCN(c2ccc3c(c2)NC(=O)C3O)CCN1 |
| InChI | InChI=1S/C13H15N3O3/c17-11-3-5-16(6-4-14-11)8-1-2-9-10(7-8)15-13(19)12(9)18/h1-2,7,12,18H,3-6H2,(H,14,17)(H,15,19) |
| InChIKey | QXBNDQFRKBPTBS-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|