C11H18N2S — CID 63006349
N-[(5-methylthiophen-2-yl)methyl]-1-pyrrolidin-3-ylmethanamine (PubChem CID 63006349) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]-1-pyrrolidin-3-ylmethanamine.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]-1-pyrrolidin-3-ylmethanamine |
|---|---|
| PubChem CID | 63006349 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]-1-pyrrolidin-3-ylmethanamine |
| SMILES | Cc1ccc(CNCC2CCNC2)s1 |
| InChI | InChI=1S/C11H18N2S/c1-9-2-3-11(14-9)8-13-7-10-4-5-12-6-10/h2-3,10,12-13H,4-8H2,1H3 |
| InChIKey | FJTNFRJXVJRRHW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |