C11H12ClFN2O — CID 63007340
N-(5-chloro-2-fluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 63007340) has the molecular formula C11H12ClFN2O and a molecular weight of 242.68 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63007340 |
| Molecular Formula | C11H12ClFN2O |
| Molecular Weight | 242.68 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1F)C1CCNC1 |
| InChI | InChI=1S/C11H12ClFN2O/c12-8-1-2-9(13)10(5-8)15-11(16)7-3-4-14-6-7/h1-2,5,7,14H,3-4,6H2,(H,15,16) |
| InChIKey | JAGWKTBUYJQPNG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.68 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |