C11H24N2O2 — CID 63009481
(2S,3S)-2-amino-N-(3-methoxypropyl)-N,3-dimethylpentanamide (PubChem CID 63009481) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is (2S,3S)-2-amino-N-(3-methoxypropyl)-N,3-dimethylpentanamide.
| Compound Name | (2S,3S)-2-amino-N-(3-methoxypropyl)-N,3-dimethylpentanamide |
|---|---|
| PubChem CID | 63009481 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | (2S,3S)-2-amino-N-(3-methoxypropyl)-N,3-dimethylpentanamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N(C)CCCOC |
| InChI | InChI=1S/C11H24N2O2/c1-5-9(2)10(12)11(14)13(3)7-6-8-15-4/h9-10H,5-8,12H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | MFGPREQRBRBIPR-UWVGGRQHSA-N |
| XLogP | 0.85 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|