About N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine
N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine (PubChem CID 63009933) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine |
| PubChem CID | 63009933 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine |
| SMILES | COCCCN(C)CC(C)CNC1CC1 |
| InChI | InChI=1S/C12H26N2O/c1-11(9-13-12-5-6-12)10-14(2)7-4-8-15-3/h11-13H,4-10H2,1-3H3 |
| InChIKey | ABZIAQKUNYGNOX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine?
The IUPAC name of N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine (CID 63009933) is N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine.
What is the SMILES notation for N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine?
The canonical SMILES for N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine is COCCCN(C)CC(C)CNC1CC1.
What is the InChIKey of N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine?
The InChIKey is ABZIAQKUNYGNOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-11(9-13-12-5-6-12)10-14(2)7-4-8-15-3/h11-13H,4-10H2,1-3H3.
What are the key properties of N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine?
N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine has a molecular weight of 214.35 g/mol, XLogP of 1.34, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N'-(3-methoxypropyl)-N',2-dimethylpropane-1,3-diamine is sourced from PubChem (CID 63009933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).