C16H17ClN2S — CID 63010770
5-chloro-2-(1-phenylpropan-2-ylamino)benzenecarbothioamide (PubChem CID 63010770) has the molecular formula C16H17ClN2S and a molecular weight of 304.85 g/mol. Its IUPAC name is 5-chloro-2-(1-phenylpropan-2-ylamino)benzenecarbothioamide.
| Compound Name | 5-chloro-2-(1-phenylpropan-2-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 63010770 |
| Molecular Formula | C16H17ClN2S |
| Molecular Weight | 304.85 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 5-chloro-2-(1-phenylpropan-2-ylamino)benzenecarbothioamide |
| SMILES | CC(Cc1ccccc1)Nc1ccc(Cl)cc1C(N)=S |
| InChI | InChI=1S/C16H17ClN2S/c1-11(9-12-5-3-2-4-6-12)19-15-8-7-13(17)10-14(15)16(18)20/h2-8,10-11,19H,9H2,1H3,(H2,18,20) |
| InChIKey | PWUBJZXDJYEWNL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|