C21H22N2S — CID 6301155
2-[(E)-2-(1,2,3,3-tetramethyl-2H-indol-5-yl)ethenyl]-1,3-benzothiazole (PubChem CID 6301155) has the molecular formula C21H22N2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 2-[(E)-2-(1,2,3,3-tetramethyl-2H-indol-5-yl)ethenyl]-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-(1,2,3,3-tetramethyl-2H-indol-5-yl)ethenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 6301155 |
| Molecular Formula | C21H22N2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-[(E)-2-(1,2,3,3-tetramethyl-2H-indol-5-yl)ethenyl]-1,3-benzothiazole |
| SMILES | CC1N(C)c2ccc(/C=C/c3nc4ccccc4s3)cc2C1(C)C |
| InChI | InChI=1S/C21H22N2S/c1-14-21(2,3)16-13-15(9-11-18(16)23(14)4)10-12-20-22-17-7-5-6-8-19(17)24-20/h5-14H,1-4H3/b12-10+ |
| InChIKey | CNQWFRBCZOAYME-ZRDIBKRKSA-N |
| XLogP | 5.58 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|