About 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine
7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (PubChem CID 63013048) has the molecular formula C11H18N4
and a molecular weight of 206.29 g/mol. Its IUPAC name is 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| PubChem CID | 63013048 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| SMILES | c1cn2c(n1)CN(C1CCNCC1)CC2 |
| InChI | InChI=1S/C11H18N4/c1-3-12-4-2-10(1)15-8-7-14-6-5-13-11(14)9-15/h5-6,10,12H,1-4,7-9H2 |
| InChIKey | UHXRVXHGFRZYJM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The IUPAC name of 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (CID 63013048) is 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
What is the SMILES notation for 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The canonical SMILES for 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine is c1cn2c(n1)CN(C1CCNCC1)CC2.
What is the InChIKey of 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The InChIKey is UHXRVXHGFRZYJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4/c1-3-12-4-2-10(1)15-8-7-14-6-5-13-11(14)9-15/h5-6,10,12H,1-4,7-9H2.
What are the key properties of 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine has a molecular weight of 206.29 g/mol, XLogP of 0.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-piperidin-4-yl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine is sourced from PubChem (CID 63013048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).