About 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine
4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine (PubChem CID 63013669) has the molecular formula C14H14Cl2N2O2
and a molecular weight of 313.18 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine |
| PubChem CID | 63013669 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1onc(C2CCCOC2)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c15-10-4-3-8(6-11(10)16)12-13(18-20-14(12)17)9-2-1-5-19-7-9/h3-4,6,9H,1-2,5,7,17H2 |
| InChIKey | LJMFHJFFPBRLGY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine?
The IUPAC name of 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine (CID 63013669) is 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine.
What is the SMILES notation for 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine?
The canonical SMILES for 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine is Nc1onc(C2CCCOC2)c1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine?
The InChIKey is LJMFHJFFPBRLGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2O2/c15-10-4-3-8(6-11(10)16)12-13(18-20-14(12)17)9-2-1-5-19-7-9/h3-4,6,9H,1-2,5,7,17H2.
What are the key properties of 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine?
4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine has a molecular weight of 313.18 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dichlorophenyl)-3-(oxan-3-yl)-1,2-oxazol-5-amine is sourced from PubChem (CID 63013669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).