About [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine
[2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine (PubChem CID 63014427) has the molecular formula C12H20N4
and a molecular weight of 220.32 g/mol. Its IUPAC name is [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine.
Molecular Properties
| Compound Name | [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine |
| PubChem CID | 63014427 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine |
| SMILES | NCC1CCCC1N1CCn2ccnc2C1 |
| InChI | InChI=1S/C12H20N4/c13-8-10-2-1-3-11(10)16-7-6-15-5-4-14-12(15)9-16/h4-5,10-11H,1-3,6-9,13H2 |
| InChIKey | HUMZUEYYPDUVJK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine?
The IUPAC name of [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine (CID 63014427) is [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine.
What is the SMILES notation for [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine?
The canonical SMILES for [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine is NCC1CCCC1N1CCn2ccnc2C1.
What is the InChIKey of [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine?
The InChIKey is HUMZUEYYPDUVJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4/c13-8-10-2-1-3-11(10)16-7-6-15-5-4-14-12(15)9-16/h4-5,10-11H,1-3,6-9,13H2.
What are the key properties of [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine?
[2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine has a molecular weight of 220.32 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)cyclopentyl]methanamine is sourced from PubChem (CID 63014427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).