About [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine
[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine (PubChem CID 63014488) has the molecular formula C14H18N4O2S
and a molecular weight of 306.39 g/mol. Its IUPAC name is [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine |
| PubChem CID | 63014488 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine |
| SMILES | NCc1ccc(CS(=O)(=O)N2CCn3ccnc3C2)cc1 |
| InChI | InChI=1S/C14H18N4O2S/c15-9-12-1-3-13(4-2-12)11-21(19,20)18-8-7-17-6-5-16-14(17)10-18/h1-6H,7-11,15H2 |
| InChIKey | RQEMWVJLZDMKMP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine?
The IUPAC name of [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine (CID 63014488) is [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine.
What is the SMILES notation for [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine?
The canonical SMILES for [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine is NCc1ccc(CS(=O)(=O)N2CCn3ccnc3C2)cc1.
What is the InChIKey of [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine?
The InChIKey is RQEMWVJLZDMKMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2S/c15-9-12-1-3-13(4-2-12)11-21(19,20)18-8-7-17-6-5-16-14(17)10-18/h1-6H,7-11,15H2.
What are the key properties of [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine?
[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine has a molecular weight of 306.39 g/mol, XLogP of 0.69, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonylmethyl)phenyl]methanamine is sourced from PubChem (CID 63014488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).