C11H19N3O — CID 63014682
5-butan-2-yl-3-piperidin-4-yl-1,2,4-oxadiazole (PubChem CID 63014682) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 5-butan-2-yl-3-piperidin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-butan-2-yl-3-piperidin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63014682 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 5-butan-2-yl-3-piperidin-4-yl-1,2,4-oxadiazole |
| SMILES | CCC(C)c1nc(C2CCNCC2)no1 |
| InChI | InChI=1S/C11H19N3O/c1-3-8(2)11-13-10(14-15-11)9-4-6-12-7-5-9/h8-9,12H,3-7H2,1-2H3 |
| InChIKey | FQYUNTKHHCNYBQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |