About (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone
(6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone (PubChem CID 63014872) has the molecular formula C11H10ClN5O
and a molecular weight of 263.69 g/mol. Its IUPAC name is (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone.
Molecular Properties
| Compound Name | (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone |
| PubChem CID | 63014872 |
| Molecular Formula | C11H10ClN5O |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone |
| SMILES | O=C(c1ccc(Cl)nn1)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C11H10ClN5O/c12-9-2-1-8(14-15-9)11(18)17-6-5-16-4-3-13-10(16)7-17/h1-4H,5-7H2 |
| InChIKey | XKTDYIHZOVLBLF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone?
The IUPAC name of (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone (CID 63014872) is (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone.
What is the SMILES notation for (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone?
The canonical SMILES for (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone is O=C(c1ccc(Cl)nn1)N1CCn2ccnc2C1.
What is the InChIKey of (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone?
The InChIKey is XKTDYIHZOVLBLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN5O/c12-9-2-1-8(14-15-9)11(18)17-6-5-16-4-3-13-10(16)7-17/h1-4H,5-7H2.
What are the key properties of (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone?
(6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone has a molecular weight of 263.69 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloropyridazin-3-yl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone is sourced from PubChem (CID 63014872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).