C11H14N4O — CID 63014932
3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine (PubChem CID 63014932) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine.
| Compound Name | 3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
|---|---|
| PubChem CID | 63014932 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| SMILES | Nc1ccc2nnc(C3CCCOC3)n2c1 |
| InChI | InChI=1S/C11H14N4O/c12-9-3-4-10-13-14-11(15(10)6-9)8-2-1-5-16-7-8/h3-4,6,8H,1-2,5,7,12H2 |
| InChIKey | XBGQDIBDVMZHCL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |