C15H14Cl2O2 — CID 63016213
1-(3,5-dichlorophenyl)-2-(2-methoxyphenyl)ethanol (PubChem CID 63016213) has the molecular formula C15H14Cl2O2 and a molecular weight of 297.18 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-2-(2-methoxyphenyl)ethanol.
| Compound Name | 1-(3,5-dichlorophenyl)-2-(2-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 63016213 |
| Molecular Formula | C15H14Cl2O2 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-2-(2-methoxyphenyl)ethanol |
| SMILES | COc1ccccc1CC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2O2/c1-19-15-5-3-2-4-10(15)8-14(18)11-6-12(16)9-13(17)7-11/h2-7,9,14,18H,8H2,1H3 |
| InChIKey | CNTFMKNGTAQANT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |