C13H19ClO — CID 63017925
1-(3-chlorophenyl)-3-methylhexan-2-ol (PubChem CID 63017925) has the molecular formula C13H19ClO and a molecular weight of 226.75 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-methylhexan-2-ol.
| Compound Name | 1-(3-chlorophenyl)-3-methylhexan-2-ol |
|---|---|
| PubChem CID | 63017925 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-(3-chlorophenyl)-3-methylhexan-2-ol |
| SMILES | CCCC(C)C(O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H19ClO/c1-3-5-10(2)13(15)9-11-6-4-7-12(14)8-11/h4,6-8,10,13,15H,3,5,9H2,1-2H3 |
| InChIKey | YGJNDOANYRGYDX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |