About 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine
1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine (PubChem CID 63019189) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine.
Molecular Properties
| Compound Name | 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine |
| PubChem CID | 63019189 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine |
| SMILES | C(#Cc1ccc2c(c1)COC2)CN1CCNCC1 |
| InChI | InChI=1S/C15H18N2O/c1(7-17-8-5-16-6-9-17)2-13-3-4-14-11-18-12-15(14)10-13/h3-4,10,16H,5-9,11-12H2 |
| InChIKey | AARAAWLOUNEVTF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine?
The IUPAC name of 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine (CID 63019189) is 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine.
What is the SMILES notation for 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine?
The canonical SMILES for 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine is C(#Cc1ccc2c(c1)COC2)CN1CCNCC1.
What is the InChIKey of 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine?
The InChIKey is AARAAWLOUNEVTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O/c1(7-17-8-5-16-6-9-17)2-13-3-4-14-11-18-12-15(14)10-13/h3-4,10,16H,5-9,11-12H2.
What are the key properties of 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine?
1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine has a molecular weight of 242.32 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(1,3-dihydro-2-benzofuran-5-yl)prop-2-ynyl]piperazine is sourced from PubChem (CID 63019189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).