About 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol
1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol (PubChem CID 63019202) has the molecular formula C19H24O2
and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol.
Molecular Properties
| Compound Name | 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol |
| PubChem CID | 63019202 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol |
| SMILES | OC(c1ccc2c(c1)COC2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H24O2/c20-18(15-1-2-16-10-21-11-17(16)6-15)19-7-12-3-13(8-19)5-14(4-12)9-19/h1-2,6,12-14,18,20H,3-5,7-11H2 |
| InChIKey | WYBAPHHPJNYQTA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol?
The IUPAC name of 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol (CID 63019202) is 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol.
What is the SMILES notation for 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol?
The canonical SMILES for 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol is OC(c1ccc2c(c1)COC2)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol?
The InChIKey is WYBAPHHPJNYQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O2/c20-18(15-1-2-16-10-21-11-17(16)6-15)19-7-12-3-13(8-19)5-14(4-12)9-19/h1-2,6,12-14,18,20H,3-5,7-11H2.
What are the key properties of 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol?
1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol has a molecular weight of 284.40 g/mol, XLogP of 3.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl(1,3-dihydro-2-benzofuran-5-yl)methanol is sourced from PubChem (CID 63019202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).